C33H64N2O4 — CID 153374844
3-[3-(dibutylamino)propylamino]-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid (PubChem CID 153374844) has the molecular formula C33H64N2O4 and a molecular weight of 552.89 g/mol. Its IUPAC name is 3-[3-(dibutylamino)propylamino]-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid.
| Compound Name | 3-[3-(dibutylamino)propylamino]-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 153374844 |
| Molecular Formula | C33H64N2O4 |
| Molecular Weight | 552.89 g/mol |
| Exact Mass | 552.49 |
| IUPAC Name | 3-[3-(dibutylamino)propylamino]-4-[(Z)-octadec-9-enoxy]-4-oxobutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)C(CC(=O)O)NCCCN(CCCC)CCCC |
| InChI | InChI=1S/C33H64N2O4/c1-4-7-10-11-12-13-14-15-16-17-18-19-20-21-22-23-29-39-33(38)31(30-32(36)37)34-25-24-28-35(26-8-5-2)27-9-6-3/h15-16,31,34H,4-14,17-30H2,1-3H3,(H,36,37)/b16-15- |
| InChIKey | QPZVHFAFJUNEPK-NXVVXOECSA-N |
| XLogP | 8.29 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.89 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|