C41H78N2O9 — CID 153295814
2-[3-(dibutylamino)propylamino]-4-[2-[2-[2-[2-[(Z)-octadec-9-enoyl]oxyethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid (PubChem CID 153295814) has the molecular formula C41H78N2O9 and a molecular weight of 743.08 g/mol. Its IUPAC name is 2-[3-(dibutylamino)propylamino]-4-[2-[2-[2-[2-[(Z)-octadec-9-enoyl]oxyethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid.
| Compound Name | 2-[3-(dibutylamino)propylamino]-4-[2-[2-[2-[2-[(Z)-octadec-9-enoyl]oxyethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 153295814 |
| Molecular Formula | C41H78N2O9 |
| Molecular Weight | 743.08 g/mol |
| Exact Mass | 742.57 |
| IUPAC Name | 2-[3-(dibutylamino)propylamino]-4-[2-[2-[2-[2-[(Z)-octadec-9-enoyl]oxyethoxy]ethoxy]ethoxy]ethoxy]-4-oxobutanoic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCCOCCOCCOCCOC(=O)CC(NCCCN(CCCC)CCCC)C(=O)O |
| InChI | InChI=1S/C41H78N2O9/c1-4-7-10-11-12-13-14-15-16-17-18-19-20-21-22-24-39(44)51-35-33-49-31-29-48-30-32-50-34-36-52-40(45)37-38(41(46)47)42-25-23-28-43(26-8-5-2)27-9-6-3/h15-16,38,42H,4-14,17-37H2,1-3H3,(H,46,47)/b16-15- |
| InChIKey | UTTPFTVMBQUWEI-NXVVXOECSA-N |
| XLogP | 7.89 |
| TPSA | 132.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.08 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|