C42H80ClNO5 — CID 173188784
2-[2-hydroxyethyl(2-octadec-9-enoyloxyethyl)amino]ethyl octadec-9-enoate;hydrochloride (PubChem CID 173188784) has the molecular formula C42H80ClNO5 and a molecular weight of 714.56 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(2-octadec-9-enoyloxyethyl)amino]ethyl octadec-9-enoate;hydrochloride.
| Compound Name | 2-[2-hydroxyethyl(2-octadec-9-enoyloxyethyl)amino]ethyl octadec-9-enoate;hydrochloride |
|---|---|
| PubChem CID | 173188784 |
| Molecular Formula | C42H80ClNO5 |
| Molecular Weight | 714.56 g/mol |
| Exact Mass | 713.57 |
| IUPAC Name | 2-[2-hydroxyethyl(2-octadec-9-enoyloxyethyl)amino]ethyl octadec-9-enoate;hydrochloride |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCN(CCO)CCOC(=O)CCCCCCCC=CCCCCCCCC.Cl |
| InChI | InChI=1S/C42H79NO5.ClH/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-41(45)47-39-36-43(35-38-44)37-40-48-42(46)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20,44H,3-16,21-40H2,1-2H3;1H |
| InChIKey | CFXAOJMRSYUBTP-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.56 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|