C60H115N3O3 — CID 171586173
10-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decyl 10-[2-aminoethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decanoate (PubChem CID 171586173) has the molecular formula C60H115N3O3 and a molecular weight of 926.60 g/mol. Its IUPAC name is 10-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decyl 10-[2-aminoethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decanoate.
| Compound Name | 10-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decyl 10-[2-aminoethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decanoate |
|---|---|
| PubChem CID | 171586173 |
| Molecular Formula | C60H115N3O3 |
| Molecular Weight | 926.60 g/mol |
| Exact Mass | 925.89 |
| IUPAC Name | 10-[2-hydroxyethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decyl 10-[2-aminoethyl-[(9Z,12Z)-octadeca-9,12-dienyl]amino]decanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCN)CCCCCCCCCC(=O)OCCCCCCCCCCN(CCO)CCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C60H115N3O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-33-39-45-52-62(56-51-61)53-46-40-36-31-32-38-44-50-60(65)66-59-49-43-37-30-29-35-42-48-55-63(57-58-64)54-47-41-34-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,64H,3-10,15-16,21-59,61H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
| InChIKey | JFLBVXBDWRWKJH-MAZCIEHSSA-N |
| XLogP | 16.95 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.60 |
| LogP ≤ 5 | 16.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|