C28H56N2O5 — CID 53423503
2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate (PubChem CID 53423503) has the molecular formula C28H56N2O5 and a molecular weight of 500.77 g/mol. Its IUPAC name is 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate.
| Compound Name | 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate |
|---|---|
| PubChem CID | 53423503 |
| Molecular Formula | C28H56N2O5 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.42 |
| IUPAC Name | 2-[2-[bis(2-hydroxyethyl)amino]ethyl-(2-hydroxyethyl)amino]ethyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCCN(CCO)CCN(CCO)CCO |
| InChI | InChI=1S/C28H56N2O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-28(34)35-27-23-30(22-26-33)19-18-29(20-24-31)21-25-32/h9-10,31-33H,2-8,11-27H2,1H3 |
| InChIKey | XJSIQJZKJMJHDU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|