C27H25N3O5S — CID 153375836
4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2(7),3,5,8-tetraene-11,14,16-trione (PubChem CID 153375836) has the molecular formula C27H25N3O5S and a molecular weight of 503.58 g/mol. Its IUPAC name is 4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2(7),3,5,8-tetraene-11,14,16-trione.
| Compound Name | 4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2(7),3,5,8-tetraene-11,14,16-trione |
|---|---|
| PubChem CID | 153375836 |
| Molecular Formula | C27H25N3O5S |
| Molecular Weight | 503.58 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 4-[2-[4-(1-benzothiophen-4-yl)piperazin-1-yl]ethyl]-10,15-dioxa-1-azatricyclo[7.6.1.02,7]hexadeca-2(7),3,5,8-tetraene-11,14,16-trione |
| SMILES | O=C1CCC(=O)On2c(=O)c(cc3ccc(CCN4CCN(c5cccc6sccc56)CC4)cc32)O1 |
| InChI | InChI=1S/C27H25N3O5S/c31-25-6-7-26(32)35-30-22-16-18(4-5-19(22)17-23(34-25)27(30)33)8-10-28-11-13-29(14-12-28)21-2-1-3-24-20(21)9-15-36-24/h1-5,9,15-17H,6-8,10-14H2 |
| InChIKey | OYUCSJHMBGJELV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |