C9H14F2N2O4S — CID 153375867
3-(difluoromethyl)-1-methyl-4-methylsulfonylpyrazole-5-carboxylic acid;ethane (PubChem CID 153375867) has the molecular formula C9H14F2N2O4S and a molecular weight of 284.28 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-4-methylsulfonylpyrazole-5-carboxylic acid;ethane.
| Compound Name | 3-(difluoromethyl)-1-methyl-4-methylsulfonylpyrazole-5-carboxylic acid;ethane |
|---|---|
| PubChem CID | 153375867 |
| Molecular Formula | C9H14F2N2O4S |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-4-methylsulfonylpyrazole-5-carboxylic acid;ethane |
| SMILES | CC.Cn1nc(C(F)F)c(S(C)(=O)=O)c1C(=O)O |
| InChI | InChI=1S/C7H8F2N2O4S.C2H6/c1-11-4(7(12)13)5(16(2,14)15)3(10-11)6(8)9;1-2/h6H,1-2H3,(H,12,13);1-2H3 |
| InChIKey | SYZXPBZNYCMIQI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |