C13H18BrIN2OS — CID 153376848
4-bromo-1-(oxetan-2-ylmethyl)pyrrolo[3,2-c]pyridine;ethane;thiohypoiodous acid (PubChem CID 153376848) has the molecular formula C13H18BrIN2OS and a molecular weight of 457.18 g/mol. Its IUPAC name is 4-bromo-1-(oxetan-2-ylmethyl)pyrrolo[3,2-c]pyridine;ethane;thiohypoiodous acid.
| Compound Name | 4-bromo-1-(oxetan-2-ylmethyl)pyrrolo[3,2-c]pyridine;ethane;thiohypoiodous acid |
|---|---|
| PubChem CID | 153376848 |
| Molecular Formula | C13H18BrIN2OS |
| Molecular Weight | 457.18 g/mol |
| Exact Mass | 455.94 |
| IUPAC Name | 4-bromo-1-(oxetan-2-ylmethyl)pyrrolo[3,2-c]pyridine;ethane;thiohypoiodous acid |
| SMILES | Brc1nccc2c1ccn2CC1CCO1.CC.SI |
| InChI | InChI=1S/C11H11BrN2O.C2H6.HIS/c12-11-9-2-5-14(7-8-3-6-15-8)10(9)1-4-13-11;2*1-2/h1-2,4-5,8H,3,6-7H2;1-2H3;2H |
| InChIKey | ZIZIJEKSRKJNDT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 27.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.18 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|