C20H25FN2S — CID 153377665
(Z)-3-amino-2-[5-[3-(3-fluorophenyl)propyl]-2-sulfanylcyclohepten-1-yl]but-2-enenitrile (PubChem CID 153377665) has the molecular formula C20H25FN2S and a molecular weight of 344.50 g/mol. Its IUPAC name is (Z)-3-amino-2-[5-[3-(3-fluorophenyl)propyl]-2-sulfanylcyclohepten-1-yl]but-2-enenitrile.
| Compound Name | (Z)-3-amino-2-[5-[3-(3-fluorophenyl)propyl]-2-sulfanylcyclohepten-1-yl]but-2-enenitrile |
|---|---|
| PubChem CID | 153377665 |
| Molecular Formula | C20H25FN2S |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | (Z)-3-amino-2-[5-[3-(3-fluorophenyl)propyl]-2-sulfanylcyclohepten-1-yl]but-2-enenitrile |
| SMILES | C/C(N)=C(/C#N)C1=C(S)CCC(CCCc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C20H25FN2S/c1-14(23)19(13-22)18-10-8-15(9-11-20(18)24)4-2-5-16-6-3-7-17(21)12-16/h3,6-7,12,15,24H,2,4-5,8-11,23H2,1H3/b19-14+ |
| InChIKey | DBZUCLMCQZDJCA-XMHGGMMESA-N |
| XLogP | 5.28 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|