C17H17N3O2S — CID 153381122
N-(5-ethyl-2-methoxyphenyl)sulfanyl-5-phenyl-1,3,4-oxadiazol-2-amine (PubChem CID 153381122) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is N-(5-ethyl-2-methoxyphenyl)sulfanyl-5-phenyl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(5-ethyl-2-methoxyphenyl)sulfanyl-5-phenyl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 153381122 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-(5-ethyl-2-methoxyphenyl)sulfanyl-5-phenyl-1,3,4-oxadiazol-2-amine |
| SMILES | CCc1ccc(OC)c(SNc2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C17H17N3O2S/c1-3-12-9-10-14(21-2)15(11-12)23-20-17-19-18-16(22-17)13-7-5-4-6-8-13/h4-11H,3H2,1-2H3,(H,19,20) |
| InChIKey | PFNKIABUIRFGSR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|