C17H18N4O3 — CID 91681625
[5-[4-methoxy-3-[(4-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]hydrazine (PubChem CID 91681625) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is [5-[4-methoxy-3-[(4-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]hydrazine.
| Compound Name | [5-[4-methoxy-3-[(4-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 91681625 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | [5-[4-methoxy-3-[(4-methylphenyl)methoxy]phenyl]-1,3,4-oxadiazol-2-yl]hydrazine |
| SMILES | COc1ccc(-c2nnc(NN)o2)cc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C17H18N4O3/c1-11-3-5-12(6-4-11)10-23-15-9-13(7-8-14(15)22-2)16-20-21-17(19-18)24-16/h3-9H,10,18H2,1-2H3,(H,19,21) |
| InChIKey | GOQBKMHHAKQGLZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 95.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|