C26H30Cl2N6O3 — CID 153382605
N-[(E)-3-amino-1-imino-4-oxo-4-[[1-[[3-(propanoylamino)phenyl]methyl]piperidin-4-yl]amino]but-2-en-2-yl]-2,6-dichlorobenzamide (PubChem CID 153382605) has the molecular formula C26H30Cl2N6O3 and a molecular weight of 545.47 g/mol. Its IUPAC name is N-[(E)-3-amino-1-imino-4-oxo-4-[[1-[[3-(propanoylamino)phenyl]methyl]piperidin-4-yl]amino]but-2-en-2-yl]-2,6-dichlorobenzamide.
| Compound Name | N-[(E)-3-amino-1-imino-4-oxo-4-[[1-[[3-(propanoylamino)phenyl]methyl]piperidin-4-yl]amino]but-2-en-2-yl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 153382605 |
| Molecular Formula | C26H30Cl2N6O3 |
| Molecular Weight | 545.47 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-[(E)-3-amino-1-imino-4-oxo-4-[[1-[[3-(propanoylamino)phenyl]methyl]piperidin-4-yl]amino]but-2-en-2-yl]-2,6-dichlorobenzamide |
| SMILES | [H]/N=C/C(NC(=O)c1c(Cl)cccc1Cl)=C(\N)C(=O)NC1CCN(Cc2cccc(NC(=O)CC)c2)CC1 |
| InChI | InChI=1S/C26H30Cl2N6O3/c1-2-22(35)31-18-6-3-5-16(13-18)15-34-11-9-17(10-12-34)32-26(37)24(30)21(14-29)33-25(36)23-19(27)7-4-8-20(23)28/h3-8,13-14,17,29H,2,9-12,15,30H2,1H3,(H,31,35)(H,32,37)(H,33,36)/b24-21+,29-14+ |
| InChIKey | FRVYPDLVTQXSTP-DWLQZKIMSA-N |
| XLogP | 3.67 |
| TPSA | 140.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|