C26H35FN6O — CID 153382850
2-fluoro-6-[6-methyl-5-(methyldiazenyl)-3-pyridinyl]-3-(1H-pyrazol-4-yl)phenol;2,2,4,6,6-pentamethylpiperidine (PubChem CID 153382850) has the molecular formula C26H35FN6O and a molecular weight of 466.61 g/mol. Its IUPAC name is 2-fluoro-6-[6-methyl-5-(methyldiazenyl)-3-pyridinyl]-3-(1H-pyrazol-4-yl)phenol;2,2,4,6,6-pentamethylpiperidine.
| Compound Name | 2-fluoro-6-[6-methyl-5-(methyldiazenyl)-3-pyridinyl]-3-(1H-pyrazol-4-yl)phenol;2,2,4,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 153382850 |
| Molecular Formula | C26H35FN6O |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | 2-fluoro-6-[6-methyl-5-(methyldiazenyl)-3-pyridinyl]-3-(1H-pyrazol-4-yl)phenol;2,2,4,6,6-pentamethylpiperidine |
| SMILES | C/N=N/c1cc(-c2ccc(-c3cn[nH]c3)c(F)c2O)cnc1C.CC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C16H14FN5O.C10H21N/c1-9-14(22-18-2)5-10(6-19-9)13-4-3-12(15(17)16(13)23)11-7-20-21-8-11;1-8-6-9(2,3)11-10(4,5)7-8/h3-8,23H,1-2H3,(H,20,21);8,11H,6-7H2,1-5H3/b22-18+; |
| InChIKey | NORWLHIWAGUSEI-MLWJBJAVSA-N |
| XLogP | 6.57 |
| TPSA | 98.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|