C26H35FN6O — CID 153383186
acetylene;(3S)-3-fluoropiperidine;N-[(2E,4Z)-5-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-3-methyl-5-(methylideneamino)penta-2,4-dien-2-yl]-N'-methylethanimidamide (PubChem CID 153383186) has the molecular formula C26H35FN6O and a molecular weight of 466.61 g/mol. Its IUPAC name is acetylene;(3S)-3-fluoropiperidine;N-[(2E,4Z)-5-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-3-methyl-5-(methylideneamino)penta-2,4-dien-2-yl]-N'-methylethanimidamide.
| Compound Name | acetylene;(3S)-3-fluoropiperidine;N-[(2E,4Z)-5-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-3-methyl-5-(methylideneamino)penta-2,4-dien-2-yl]-N'-methylethanimidamide |
|---|---|
| PubChem CID | 153383186 |
| Molecular Formula | C26H35FN6O |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | acetylene;(3S)-3-fluoropiperidine;N-[(2E,4Z)-5-[2-hydroxy-4-(1H-pyrazol-4-yl)phenyl]-3-methyl-5-(methylideneamino)penta-2,4-dien-2-yl]-N'-methylethanimidamide |
| SMILES | C#C.C=N/C(=C\C(C)=C(/C)N/C(C)=N/C)c1ccc(-c2cn[nH]c2)cc1O.F[C@H]1CCCNC1 |
| InChI | InChI=1S/C19H23N5O.C5H10FN.C2H2/c1-12(13(2)24-14(3)20-4)8-18(21-5)17-7-6-15(9-19(17)25)16-10-22-23-11-16;6-5-2-1-3-7-4-5;1-2/h6-11,25H,5H2,1-4H3,(H,20,24)(H,22,23);5,7H,1-4H2;1-2H/b13-12+,18-8-;;/t;5-;/m.0./s1 |
| InChIKey | POBKHEHOBPEESZ-XFQAVNGVSA-N |
| XLogP | 4.71 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|