C21H25FN5P — CID 153383239
N-[6-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-methyl-3-pyridinyl]-1-piperidin-4-ylphosphanylethanimine (PubChem CID 153383239) has the molecular formula C21H25FN5P and a molecular weight of 397.44 g/mol. Its IUPAC name is N-[6-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-methyl-3-pyridinyl]-1-piperidin-4-ylphosphanylethanimine.
| Compound Name | N-[6-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-methyl-3-pyridinyl]-1-piperidin-4-ylphosphanylethanimine |
|---|---|
| PubChem CID | 153383239 |
| Molecular Formula | C21H25FN5P |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | N-[6-(8-fluoro-2-methylimidazo[1,2-a]pyridin-6-yl)-4-methyl-3-pyridinyl]-1-piperidin-4-ylphosphanylethanimine |
| SMILES | C/C(=N\c1cnc(-c2cc(F)c3nc(C)cn3c2)cc1C)PC1CCNCC1 |
| InChI | InChI=1S/C21H25FN5P/c1-13-8-19(16-9-18(22)21-25-14(2)11-27(21)12-16)24-10-20(13)26-15(3)28-17-4-6-23-7-5-17/h8-12,17,23,28H,4-7H2,1-3H3/b26-15+ |
| InChIKey | PCOODGATERCAID-CVKSISIWSA-N |
| XLogP | 4.63 |
| TPSA | 54.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|