C12H18FN3O — CID 153384814
N-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]formamide;N-methylaniline (PubChem CID 153384814) has the molecular formula C12H18FN3O and a molecular weight of 239.29 g/mol. Its IUPAC name is N-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]formamide;N-methylaniline.
| Compound Name | N-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]formamide;N-methylaniline |
|---|---|
| PubChem CID | 153384814 |
| Molecular Formula | C12H18FN3O |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | N-[(E)-2-(aminomethyl)-3-fluoroprop-2-enyl]formamide;N-methylaniline |
| SMILES | CNc1ccccc1.NC/C(=C\F)CNC=O |
| InChI | InChI=1S/C7H9N.C5H9FN2O/c1-8-7-5-3-2-4-6-7;6-1-5(2-7)3-8-4-9/h2-6,8H,1H3;1,4H,2-3,7H2,(H,8,9)/b;5-1+ |
| InChIKey | ITSWMYQROZCSMG-NRQZSLRPSA-N |
| XLogP | 1.27 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|