C12H16F3NO2 — CID 153386764
tert-butyl (1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate (PubChem CID 153386764) has the molecular formula C12H16F3NO2 and a molecular weight of 263.26 g/mol. Its IUPAC name is tert-butyl (1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate.
| Compound Name | tert-butyl (1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
|---|---|
| PubChem CID | 153386764 |
| Molecular Formula | C12H16F3NO2 |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | tert-butyl (1S,4R)-2-(trifluoromethyl)-7-azabicyclo[2.2.1]hept-2-ene-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2C=C(C(F)(F)F)[C@@H]1CC2 |
| InChI | InChI=1S/C12H16F3NO2/c1-11(2,3)18-10(17)16-7-4-5-9(16)8(6-7)12(13,14)15/h6-7,9H,4-5H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | VHPLVVDGNRIPLZ-APPZFPTMSA-N |
| XLogP | 3.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|