C22H30N6O5 — CID 153387393
[3-[2-(dimethylamino)ethoxy]-4-nitrophenyl]-[(3R)-3-[(4-ethoxy-5-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]methanone (PubChem CID 153387393) has the molecular formula C22H30N6O5 and a molecular weight of 458.52 g/mol. Its IUPAC name is [3-[2-(dimethylamino)ethoxy]-4-nitrophenyl]-[(3R)-3-[(4-ethoxy-5-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]methanone.
| Compound Name | [3-[2-(dimethylamino)ethoxy]-4-nitrophenyl]-[(3R)-3-[(4-ethoxy-5-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 153387393 |
| Molecular Formula | C22H30N6O5 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [3-[2-(dimethylamino)ethoxy]-4-nitrophenyl]-[(3R)-3-[(4-ethoxy-5-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]methanone |
| SMILES | CCOc1nc(N[C@@H]2CCN(C(=O)c3ccc([N+](=O)[O-])c(OCCN(C)C)c3)C2)ncc1C |
| InChI | InChI=1S/C22H30N6O5/c1-5-32-20-15(2)13-23-22(25-20)24-17-8-9-27(14-17)21(29)16-6-7-18(28(30)31)19(12-16)33-11-10-26(3)4/h6-7,12-13,17H,5,8-11,14H2,1-4H3,(H,23,24,25)/t17-/m1/s1 |
| InChIKey | YIVDQRORXSSZCJ-QGZVFWFLSA-N |
| XLogP | 2.36 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|