C19H20F3N5O2 — CID 153387592
N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide;5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 153387592) has the molecular formula C19H20F3N5O2 and a molecular weight of 407.40 g/mol. Its IUPAC name is N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide;5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide;5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 153387592 |
| Molecular Formula | C19H20F3N5O2 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | N-[4-(pyrrolidine-1-carbonyl)phenyl]prop-2-enamide;5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCCC2)cc1.Nc1ncc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H16N2O2.C5H4F3N3/c1-2-13(17)15-12-7-5-11(6-8-12)14(18)16-9-3-4-10-16;6-5(7,8)3-1-10-4(9)11-2-3/h2,5-8H,1,3-4,9-10H2,(H,15,17);1-2H,(H2,9,10,11) |
| InChIKey | AVWSOFWJHXPDEV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|