C27H33N5O3S — CID 158675494
5-[(E)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-amine;N-[4-(piperidine-1-carbonyl)phenyl]prop-2-enamide (PubChem CID 158675494) has the molecular formula C27H33N5O3S and a molecular weight of 507.66 g/mol. Its IUPAC name is 5-[(E)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-amine;N-[4-(piperidine-1-carbonyl)phenyl]prop-2-enamide.
| Compound Name | 5-[(E)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-amine;N-[4-(piperidine-1-carbonyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 158675494 |
| Molecular Formula | C27H33N5O3S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.23 |
| IUPAC Name | 5-[(E)-2-(5-tert-butyl-1,3-oxazol-2-yl)ethenyl]-1,3-thiazol-2-amine;N-[4-(piperidine-1-carbonyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(C(=O)N2CCCCC2)cc1.CC(C)(C)c1cnc(/C=C/c2cnc(N)s2)o1 |
| InChI | InChI=1S/C15H18N2O2.C12H15N3OS/c1-2-14(18)16-13-8-6-12(7-9-13)15(19)17-10-4-3-5-11-17;1-12(2,3)9-7-14-10(16-9)5-4-8-6-15-11(13)17-8/h2,6-9H,1,3-5,10-11H2,(H,16,18);4-7H,1-3H3,(H2,13,15)/b;5-4+ |
| InChIKey | IELRHGSEKIFTRX-RCKHEGBHSA-N |
| XLogP | 5.62 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|