C15H15BrF3N3O2S — CID 153387781
butyl N-[(2-bromo-1,3-thiazol-5-yl)methyl]-N-[2-(trifluoromethyl)-4-pyridinyl]carbamate (PubChem CID 153387781) has the molecular formula C15H15BrF3N3O2S and a molecular weight of 438.27 g/mol. Its IUPAC name is butyl N-[(2-bromo-1,3-thiazol-5-yl)methyl]-N-[2-(trifluoromethyl)-4-pyridinyl]carbamate.
| Compound Name | butyl N-[(2-bromo-1,3-thiazol-5-yl)methyl]-N-[2-(trifluoromethyl)-4-pyridinyl]carbamate |
|---|---|
| PubChem CID | 153387781 |
| Molecular Formula | C15H15BrF3N3O2S |
| Molecular Weight | 438.27 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | butyl N-[(2-bromo-1,3-thiazol-5-yl)methyl]-N-[2-(trifluoromethyl)-4-pyridinyl]carbamate |
| SMILES | CCCCOC(=O)N(Cc1cnc(Br)s1)c1ccnc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H15BrF3N3O2S/c1-2-3-6-24-14(23)22(9-11-8-21-13(16)25-11)10-4-5-20-12(7-10)15(17,18)19/h4-5,7-8H,2-3,6,9H2,1H3 |
| InChIKey | ICBWPUPDRAVGOX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.27 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|