C12H16F3N3O2 — CID 175744667
butyl N-[4-amino-6-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate (PubChem CID 175744667) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is butyl N-[4-amino-6-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate.
| Compound Name | butyl N-[4-amino-6-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 175744667 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | butyl N-[4-amino-6-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate |
| SMILES | CCCCOC(=O)N(C)c1cnc(C(F)(F)F)cc1N |
| InChI | InChI=1S/C12H16F3N3O2/c1-3-4-5-20-11(19)18(2)9-7-17-10(6-8(9)16)12(13,14)15/h6-7H,3-5H2,1-2H3,(H2,16,17) |
| InChIKey | QNQAHBYDFIIHCB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|