C17H25NO4 — CID 140978256
[4-[butoxycarbonyl(methyl)amino]-2,3,6-trimethylphenyl] acetate (PubChem CID 140978256) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is [4-[butoxycarbonyl(methyl)amino]-2,3,6-trimethylphenyl] acetate.
| Compound Name | [4-[butoxycarbonyl(methyl)amino]-2,3,6-trimethylphenyl] acetate |
|---|---|
| PubChem CID | 140978256 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [4-[butoxycarbonyl(methyl)amino]-2,3,6-trimethylphenyl] acetate |
| SMILES | CCCCOC(=O)N(C)c1cc(C)c(OC(C)=O)c(C)c1C |
| InChI | InChI=1S/C17H25NO4/c1-7-8-9-21-17(20)18(6)15-10-11(2)16(22-14(5)19)13(4)12(15)3/h10H,7-9H2,1-6H3 |
| InChIKey | CJNZMRHXIISKRC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|