C11H15NO2 — CID 87545490
(4-amino-2,3,6-trimethylphenyl) acetate (PubChem CID 87545490) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (4-amino-2,3,6-trimethylphenyl) acetate.
| Compound Name | (4-amino-2,3,6-trimethylphenyl) acetate |
|---|---|
| PubChem CID | 87545490 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (4-amino-2,3,6-trimethylphenyl) acetate |
| SMILES | CC(=O)Oc1c(C)cc(N)c(C)c1C |
| InChI | InChI=1S/C11H15NO2/c1-6-5-10(12)7(2)8(3)11(6)14-9(4)13/h5H,12H2,1-4H3 |
| InChIKey | KYDBTUJBEOLFMK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|