C14H18N2 — CID 153390168
(E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine (PubChem CID 153390168) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine.
| Compound Name | (E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine |
|---|---|
| PubChem CID | 153390168 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | (E)-3-(7,7a-dihydro-1H-indol-3-yl)-N,2-dimethylbut-2-en-1-imine |
| SMILES | C/N=C/C(C)=C(\C)C1=CNC2CC=CC=C12 |
| InChI | InChI=1S/C14H18N2/c1-10(8-15-3)11(2)13-9-16-14-7-5-4-6-12(13)14/h4-6,8-9,14,16H,7H2,1-3H3/b11-10+,15-8+ |
| InChIKey | UQPSSDIVVVEHII-OQYPFEDXSA-N |
| XLogP | 2.77 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|