C15H15FN4O3 — CID 153390930
(E)-2-amino-3-[4-(2-fluoro-3-pyridinyl)-3-methylphenoxy]-3-hydrazinylprop-2-enoic acid (PubChem CID 153390930) has the molecular formula C15H15FN4O3 and a molecular weight of 318.31 g/mol. Its IUPAC name is (E)-2-amino-3-[4-(2-fluoro-3-pyridinyl)-3-methylphenoxy]-3-hydrazinylprop-2-enoic acid.
| Compound Name | (E)-2-amino-3-[4-(2-fluoro-3-pyridinyl)-3-methylphenoxy]-3-hydrazinylprop-2-enoic acid |
|---|---|
| PubChem CID | 153390930 |
| Molecular Formula | C15H15FN4O3 |
| Molecular Weight | 318.31 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (E)-2-amino-3-[4-(2-fluoro-3-pyridinyl)-3-methylphenoxy]-3-hydrazinylprop-2-enoic acid |
| SMILES | Cc1cc(O/C(NN)=C(/N)C(=O)O)ccc1-c1cccnc1F |
| InChI | InChI=1S/C15H15FN4O3/c1-8-7-9(23-14(20-18)12(17)15(21)22)4-5-10(8)11-3-2-6-19-13(11)16/h2-7,20H,17-18H2,1H3,(H,21,22)/b14-12+ |
| InChIKey | ATAFJKZRSCCJSY-WYMLVPIESA-N |
| XLogP | 1.25 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.31 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|