C11H8ClFN4O2 — CID 58291743
methyl 6-amino-5-chloro-2-(2-fluoro-3-pyridinyl)pyrimidine-4-carboxylate (PubChem CID 58291743) has the molecular formula C11H8ClFN4O2 and a molecular weight of 282.66 g/mol. Its IUPAC name is methyl 6-amino-5-chloro-2-(2-fluoro-3-pyridinyl)pyrimidine-4-carboxylate.
| Compound Name | methyl 6-amino-5-chloro-2-(2-fluoro-3-pyridinyl)pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 58291743 |
| Molecular Formula | C11H8ClFN4O2 |
| Molecular Weight | 282.66 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | methyl 6-amino-5-chloro-2-(2-fluoro-3-pyridinyl)pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(-c2cccnc2F)nc(N)c1Cl |
| InChI | InChI=1S/C11H8ClFN4O2/c1-19-11(18)7-6(12)9(14)17-10(16-7)5-3-2-4-15-8(5)13/h2-4H,1H3,(H2,14,16,17) |
| InChIKey | PRTPIUFTWNSVQX-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.66 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|