C19H14BrN — CID 153391148
10-(4-bromocyclohexa-1,3-dien-1-yl)benzo[h]quinoline (PubChem CID 153391148) has the molecular formula C19H14BrN and a molecular weight of 336.23 g/mol. Its IUPAC name is 10-(4-bromocyclohexa-1,3-dien-1-yl)benzo[h]quinoline.
| Compound Name | 10-(4-bromocyclohexa-1,3-dien-1-yl)benzo[h]quinoline |
|---|---|
| PubChem CID | 153391148 |
| Molecular Formula | C19H14BrN |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 10-(4-bromocyclohexa-1,3-dien-1-yl)benzo[h]quinoline |
| SMILES | BrC1=CC=C(c2cccc3ccc4cccnc4c23)CC1 |
| InChI | InChI=1S/C19H14BrN/c20-16-10-8-13(9-11-16)17-5-1-3-14-6-7-15-4-2-12-21-19(15)18(14)17/h1-8,10,12H,9,11H2 |
| InChIKey | APAJRUXMGMUBMH-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|