C8H18ClNO3 — CID 15339203
(2R,3R)-3-amino-4-[2-(2-chloroethoxy)ethoxy]butan-2-ol (PubChem CID 15339203) has the molecular formula C8H18ClNO3 and a molecular weight of 211.69 g/mol. Its IUPAC name is (2R,3R)-3-amino-4-[2-(2-chloroethoxy)ethoxy]butan-2-ol.
| Compound Name | (2R,3R)-3-amino-4-[2-(2-chloroethoxy)ethoxy]butan-2-ol |
|---|---|
| PubChem CID | 15339203 |
| Molecular Formula | C8H18ClNO3 |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (2R,3R)-3-amino-4-[2-(2-chloroethoxy)ethoxy]butan-2-ol |
| SMILES | C[C@@H](O)[C@H](N)COCCOCCCl |
| InChI | InChI=1S/C8H18ClNO3/c1-7(11)8(10)6-13-5-4-12-3-2-9/h7-8,11H,2-6,10H2,1H3/t7-,8-/m1/s1 |
| InChIKey | OSJDTJMBRKNWBK-HTQZYQBOSA-N |
| XLogP | -0.03 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|