C7H14Cl2O2 — CID 154131394
1,2-bis(2-chloroethoxy)propane (PubChem CID 154131394) has the molecular formula C7H14Cl2O2 and a molecular weight of 201.09 g/mol. Its IUPAC name is 1,2-bis(2-chloroethoxy)propane.
| Compound Name | 1,2-bis(2-chloroethoxy)propane |
|---|---|
| PubChem CID | 154131394 |
| Molecular Formula | C7H14Cl2O2 |
| Molecular Weight | 201.09 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1,2-bis(2-chloroethoxy)propane |
| SMILES | CC(COCCCl)OCCCl |
| InChI | InChI=1S/C7H14Cl2O2/c1-7(11-5-3-9)6-10-4-2-8/h7H,2-6H2,1H3 |
| InChIKey | ZOKBKKQXMBOBOM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.09 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|