C16H26ClNO2 — CID 126575366
N-[2-[1-(2-chloroethoxy)propan-2-yloxy]ethyl]-N-ethyl-3-methylaniline (PubChem CID 126575366) has the molecular formula C16H26ClNO2 and a molecular weight of 299.84 g/mol. Its IUPAC name is N-[2-[1-(2-chloroethoxy)propan-2-yloxy]ethyl]-N-ethyl-3-methylaniline.
| Compound Name | N-[2-[1-(2-chloroethoxy)propan-2-yloxy]ethyl]-N-ethyl-3-methylaniline |
|---|---|
| PubChem CID | 126575366 |
| Molecular Formula | C16H26ClNO2 |
| Molecular Weight | 299.84 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | N-[2-[1-(2-chloroethoxy)propan-2-yloxy]ethyl]-N-ethyl-3-methylaniline |
| SMILES | CCN(CCOC(C)COCCCl)c1cccc(C)c1 |
| InChI | InChI=1S/C16H26ClNO2/c1-4-18(16-7-5-6-14(2)12-16)9-11-20-15(3)13-19-10-8-17/h5-7,12,15H,4,8-11,13H2,1-3H3 |
| InChIKey | WWDDAAAEWOPHQF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.84 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|