C7H13Cl3O2 — CID 56630886
1-chloro-2,3-bis(2-chloroethoxy)propane (PubChem CID 56630886) has the molecular formula C7H13Cl3O2 and a molecular weight of 235.54 g/mol. Its IUPAC name is 1-chloro-2,3-bis(2-chloroethoxy)propane.
| Compound Name | 1-chloro-2,3-bis(2-chloroethoxy)propane |
|---|---|
| PubChem CID | 56630886 |
| Molecular Formula | C7H13Cl3O2 |
| Molecular Weight | 235.54 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 1-chloro-2,3-bis(2-chloroethoxy)propane |
| SMILES | ClCCOCC(CCl)OCCCl |
| InChI | InChI=1S/C7H13Cl3O2/c8-1-3-11-6-7(5-10)12-4-2-9/h7H,1-6H2 |
| InChIKey | BZHXKYFTWJAWCM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.54 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|