C7H12Cl2O2 — CID 15277569
1-chloro-2-(chloromethoxy)-3-prop-2-enoxypropane (PubChem CID 15277569) has the molecular formula C7H12Cl2O2 and a molecular weight of 199.08 g/mol. Its IUPAC name is 1-chloro-2-(chloromethoxy)-3-prop-2-enoxypropane.
| Compound Name | 1-chloro-2-(chloromethoxy)-3-prop-2-enoxypropane |
|---|---|
| PubChem CID | 15277569 |
| Molecular Formula | C7H12Cl2O2 |
| Molecular Weight | 199.08 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 1-chloro-2-(chloromethoxy)-3-prop-2-enoxypropane |
| SMILES | C=CCOCC(CCl)OCCl |
| InChI | InChI=1S/C7H12Cl2O2/c1-2-3-10-5-7(4-8)11-6-9/h2,7H,1,3-6H2 |
| InChIKey | GJGVMJBGEXMZNH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.08 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|