C78H152O33 — CID 59107254
1,2,3-tris[2-[2-[2-[2-[2-[2-[2-[2-[3-(3-prop-2-enoxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propane (PubChem CID 59107254) has the molecular formula C78H152O33 and a molecular weight of 1618.04 g/mol. Its IUPAC name is 1,2,3-tris[2-[2-[2-[2-[2-[2-[2-[2-[3-(3-prop-2-enoxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propane.
| Compound Name | 1,2,3-tris[2-[2-[2-[2-[2-[2-[2-[2-[3-(3-prop-2-enoxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propane |
|---|---|
| PubChem CID | 59107254 |
| Molecular Formula | C78H152O33 |
| Molecular Weight | 1618.04 g/mol |
| Exact Mass | 1617.02 |
| IUPAC Name | 1,2,3-tris[2-[2-[2-[2-[2-[2-[2-[2-[3-(3-prop-2-enoxypropoxy)propoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propane |
| SMILES | C=CCOCCCOCCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(COCCOCCOCCOCCOCCOCCOCCOCCOCCCOCCCOCC=C)OCCOCCOCCOCCOCCOCCOCCOCCOCCCOCCCOCC=C |
| InChI | InChI=1S/C78H152O33/c1-4-13-79-16-7-19-82-22-10-25-85-28-31-88-34-37-91-40-43-94-46-49-97-52-54-100-58-60-103-64-66-106-70-72-109-76-78(111-75-74-108-69-68-105-63-62-102-57-56-99-51-48-96-45-42-93-39-36-90-33-30-87-27-12-24-84-21-9-18-81-15-6-3)77-110-73-71-107-67-65-104-61-59-101-55-53-98-50-47-95-44-41-92-38-35-89-32-29-86-26-11-23-83-20-8-17-80-14-5-2/h4-6,78H,1-3,7-77H2 |
| InChIKey | LNKAIRRLHNUBQC-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 304.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 33 |
| Rotatable Bonds | 107 |
| Heavy Atoms | 111 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1618.04 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 33 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|