C39H79O17P — CID 102161020
2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]dodecyl dihydrogen phosphate (PubChem CID 102161020) has the molecular formula C39H79O17P and a molecular weight of 851.02 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]dodecyl dihydrogen phosphate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]dodecyl dihydrogen phosphate |
|---|---|
| PubChem CID | 102161020 |
| Molecular Formula | C39H79O17P |
| Molecular Weight | 851.02 g/mol |
| Exact Mass | 850.51 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-prop-2-enoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]dodecyl dihydrogen phosphate |
| SMILES | C=CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOC(CCCCCCCCCC)COP(=O)(O)O |
| InChI | InChI=1S/C39H79O17P/c1-3-5-6-7-8-9-10-11-12-39(38-56-57(40,41)42)55-37-36-54-35-34-53-33-32-52-31-30-51-29-28-50-27-26-49-25-24-48-23-22-47-21-20-46-19-18-45-17-16-44-15-14-43-13-4-2/h4,39H,2-3,5-38H2,1H3,(H2,40,41,42) |
| InChIKey | TYIVNCUWLHTSAV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 186.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.02 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|