C30H56N2O12 — CID 172956935
(NZ)-N-[3-[2-[1-[2-[2,3-bis(2-but-3-enoxyethoxy)propoxy]ethoxy]-3-[2-[(3Z)-3-hydroxyiminopropoxy]ethoxy]propan-2-yl]oxyethoxy]propylidene]hydroxylamine (PubChem CID 172956935) has the molecular formula C30H56N2O12 and a molecular weight of 636.78 g/mol. Its IUPAC name is (NZ)-N-[3-[2-[1-[2-[2,3-bis(2-but-3-enoxyethoxy)propoxy]ethoxy]-3-[2-[(3Z)-3-hydroxyiminopropoxy]ethoxy]propan-2-yl]oxyethoxy]propylidene]hydroxylamine.
| Compound Name | (NZ)-N-[3-[2-[1-[2-[2,3-bis(2-but-3-enoxyethoxy)propoxy]ethoxy]-3-[2-[(3Z)-3-hydroxyiminopropoxy]ethoxy]propan-2-yl]oxyethoxy]propylidene]hydroxylamine |
|---|---|
| PubChem CID | 172956935 |
| Molecular Formula | C30H56N2O12 |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 636.38 |
| IUPAC Name | (NZ)-N-[3-[2-[1-[2-[2,3-bis(2-but-3-enoxyethoxy)propoxy]ethoxy]-3-[2-[(3Z)-3-hydroxyiminopropoxy]ethoxy]propan-2-yl]oxyethoxy]propylidene]hydroxylamine |
| SMILES | C=CCCOCCOCC(COCCOCC(COCCOCC/C=N\O)OCCOCC/C=N\O)OCCOCCC=C |
| InChI | InChI=1S/C30H56N2O12/c1-3-5-11-35-15-17-39-25-29(43-23-21-36-12-6-4-2)27-41-19-20-42-28-30(44-24-22-38-14-8-10-32-34)26-40-18-16-37-13-7-9-31-33/h3-4,9-10,29-30,33-34H,1-2,5-8,11-28H2/b31-9-,32-10- |
| InChIKey | LFKQTHGAHZFUGY-QIDQXIIVSA-N |
| XLogP | 2.74 |
| TPSA | 157.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|