C22H42O8 — CID 165092022
3-but-3-enoxypropan-1-ol;2-[[3-(3-but-3-enoxypropoxy)-2-(methoxymethoxy)propoxy]methyl]oxirane (PubChem CID 165092022) has the molecular formula C22H42O8 and a molecular weight of 434.57 g/mol. Its IUPAC name is 3-but-3-enoxypropan-1-ol;2-[[3-(3-but-3-enoxypropoxy)-2-(methoxymethoxy)propoxy]methyl]oxirane.
| Compound Name | 3-but-3-enoxypropan-1-ol;2-[[3-(3-but-3-enoxypropoxy)-2-(methoxymethoxy)propoxy]methyl]oxirane |
|---|---|
| PubChem CID | 165092022 |
| Molecular Formula | C22H42O8 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 3-but-3-enoxypropan-1-ol;2-[[3-(3-but-3-enoxypropoxy)-2-(methoxymethoxy)propoxy]methyl]oxirane |
| SMILES | C=CCCOCCCO.C=CCCOCCCOCC(COCC1CO1)OCOC |
| InChI | InChI=1S/C15H28O6.C7H14O2/c1-3-4-6-17-7-5-8-18-9-14(21-13-16-2)10-19-11-15-12-20-15;1-2-3-6-9-7-4-5-8/h3,14-15H,1,4-13H2,2H3;2,8H,1,3-7H2 |
| InChIKey | WWHSTEIERJQMTN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|