C7H14F2O2 — CID 175717319
1,2-bis(2-fluoroethoxy)propane (PubChem CID 175717319) has the molecular formula C7H14F2O2 and a molecular weight of 168.18 g/mol. Its IUPAC name is 1,2-bis(2-fluoroethoxy)propane.
| Compound Name | 1,2-bis(2-fluoroethoxy)propane |
|---|---|
| PubChem CID | 175717319 |
| Molecular Formula | C7H14F2O2 |
| Molecular Weight | 168.18 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 1,2-bis(2-fluoroethoxy)propane |
| SMILES | CC(COCCF)OCCF |
| InChI | InChI=1S/C7H14F2O2/c1-7(11-5-3-9)6-10-4-2-8/h7H,2-6H2,1H3 |
| InChIKey | WCTOYUZOEMULSV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|