C21H17F3IN3O2S — CID 153393085
S-iodo 1-(2,4-difluorophenyl)-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbothioate (PubChem CID 153393085) has the molecular formula C21H17F3IN3O2S and a molecular weight of 559.35 g/mol. Its IUPAC name is S-iodo 1-(2,4-difluorophenyl)-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbothioate.
| Compound Name | S-iodo 1-(2,4-difluorophenyl)-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbothioate |
|---|---|
| PubChem CID | 153393085 |
| Molecular Formula | C21H17F3IN3O2S |
| Molecular Weight | 559.35 g/mol |
| Exact Mass | 559.00 |
| IUPAC Name | S-iodo 1-(2,4-difluorophenyl)-6-fluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carbothioate |
| SMILES | CC1CN(c2cc3c(cc2F)c(=O)c(C(=O)SI)cn3-c2ccc(F)cc2F)CCN1 |
| InChI | InChI=1S/C21H17F3IN3O2S/c1-11-9-27(5-4-26-11)19-8-18-13(7-16(19)24)20(29)14(21(30)31-25)10-28(18)17-3-2-12(22)6-15(17)23/h2-3,6-8,10-11,26H,4-5,9H2,1H3 |
| InChIKey | MXSAPKCUGWIMRA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.35 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|