C23H21F3N2O5 — CID 19883281
1-(2,4-difluorophenyl)-7-(3,3-dimethoxy-4-methylpyrrolidin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 19883281) has the molecular formula C23H21F3N2O5 and a molecular weight of 462.42 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-7-(3,3-dimethoxy-4-methylpyrrolidin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(2,4-difluorophenyl)-7-(3,3-dimethoxy-4-methylpyrrolidin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 19883281 |
| Molecular Formula | C23H21F3N2O5 |
| Molecular Weight | 462.42 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-(2,4-difluorophenyl)-7-(3,3-dimethoxy-4-methylpyrrolidin-1-yl)-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | COC1(OC)CN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2F)CC1C |
| InChI | InChI=1S/C23H21F3N2O5/c1-12-9-27(11-23(12,32-2)33-3)20-8-19-14(7-17(20)26)21(29)15(22(30)31)10-28(19)18-5-4-13(24)6-16(18)25/h4-8,10,12H,9,11H2,1-3H3,(H,30,31) |
| InChIKey | VWOAOCNVHKQNHT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|