C30H28F3N5O3S — CID 23819820
1-(2,4-difluorophenyl)-7-[4-[[4-(dimethylamino)phenyl]carbamothioyl]-3-methylpiperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 23819820) has the molecular formula C30H28F3N5O3S and a molecular weight of 595.65 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-7-[4-[[4-(dimethylamino)phenyl]carbamothioyl]-3-methylpiperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 1-(2,4-difluorophenyl)-7-[4-[[4-(dimethylamino)phenyl]carbamothioyl]-3-methylpiperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 23819820 |
| Molecular Formula | C30H28F3N5O3S |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | 1-(2,4-difluorophenyl)-7-[4-[[4-(dimethylamino)phenyl]carbamothioyl]-3-methylpiperazin-1-yl]-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CC1CN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3-c2ccc(F)cc2F)CCN1C(=S)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C30H28F3N5O3S/c1-17-15-36(10-11-37(17)30(42)34-19-5-7-20(8-6-19)35(2)3)27-14-26-21(13-24(27)33)28(39)22(29(40)41)16-38(26)25-9-4-18(31)12-23(25)32/h4-9,12-14,16-17H,10-11,15H2,1-3H3,(H,34,42)(H,40,41) |
| InChIKey | FDTXIVWWRPGAOB-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|