C20H22F2N6O — CID 153393983
6-(2,4-difluorophenyl)-2-[3-[(4-methylimidazol-1-yl)methyl]azetidin-1-yl]pyridin-3-amine;formamide (PubChem CID 153393983) has the molecular formula C20H22F2N6O and a molecular weight of 400.43 g/mol. Its IUPAC name is 6-(2,4-difluorophenyl)-2-[3-[(4-methylimidazol-1-yl)methyl]azetidin-1-yl]pyridin-3-amine;formamide.
| Compound Name | 6-(2,4-difluorophenyl)-2-[3-[(4-methylimidazol-1-yl)methyl]azetidin-1-yl]pyridin-3-amine;formamide |
|---|---|
| PubChem CID | 153393983 |
| Molecular Formula | C20H22F2N6O |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 6-(2,4-difluorophenyl)-2-[3-[(4-methylimidazol-1-yl)methyl]azetidin-1-yl]pyridin-3-amine;formamide |
| SMILES | Cc1cn(CC2CN(c3nc(-c4ccc(F)cc4F)ccc3N)C2)cn1.NC=O |
| InChI | InChI=1S/C19H19F2N5.CH3NO/c1-12-7-25(11-23-12)8-13-9-26(10-13)19-17(22)4-5-18(24-19)15-3-2-14(20)6-16(15)21;2-1-3/h2-7,11,13H,8-10,22H2,1H3;1H,(H2,2,3) |
| InChIKey | OHWGZTCFCVNHPR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|