C8H12N2 — CID 153394657
(Z)-N,4-dimethylpent-2-enimidoyl cyanide (PubChem CID 153394657) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (Z)-N,4-dimethylpent-2-enimidoyl cyanide.
| Compound Name | (Z)-N,4-dimethylpent-2-enimidoyl cyanide |
|---|---|
| PubChem CID | 153394657 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (Z)-N,4-dimethylpent-2-enimidoyl cyanide |
| SMILES | C/N=C(C#N)/C=C\C(C)C |
| InChI | InChI=1S/C8H12N2/c1-7(2)4-5-8(6-9)10-3/h4-5,7H,1-3H3/b5-4-,10-8- |
| InChIKey | QAKVKMGEOYVIHX-BXPWTJTASA-N |
| XLogP | 1.79 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|