C14H15N3O3 — CID 153395194
trans-ethyl (1R,2R)-2-[(2-amino-5-cyanophenyl)carbamoyl]cyclopropane-1-carboxylate (PubChem CID 153395194) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-2-[(2-amino-5-cyanophenyl)carbamoyl]cyclopropane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-2-[(2-amino-5-cyanophenyl)carbamoyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 153395194 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | trans-ethyl (1R,2R)-2-[(2-amino-5-cyanophenyl)carbamoyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1C(=O)Nc1cc(C#N)ccc1N |
| InChI | InChI=1S/C14H15N3O3/c1-2-20-14(19)10-6-9(10)13(18)17-12-5-8(7-15)3-4-11(12)16/h3-5,9-10H,2,6,16H2,1H3,(H,17,18)/t9-,10-/m1/s1 |
| InChIKey | CUTNBJFDOQUWKY-NXEZZACHSA-N |
| XLogP | 1.28 |
| TPSA | 105.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|