C16H22N4O2 — CID 176671996
[(1R,3S)-3-[(2-amino-5-cyanoanilino)methyl]cyclohexyl]methylcarbamic acid (PubChem CID 176671996) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is [(1R,3S)-3-[(2-amino-5-cyanoanilino)methyl]cyclohexyl]methylcarbamic acid.
| Compound Name | [(1R,3S)-3-[(2-amino-5-cyanoanilino)methyl]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 176671996 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [(1R,3S)-3-[(2-amino-5-cyanoanilino)methyl]cyclohexyl]methylcarbamic acid |
| SMILES | N#Cc1ccc(N)c(NC[C@H]2CCC[C@@H](CNC(=O)O)C2)c1 |
| InChI | InChI=1S/C16H22N4O2/c17-8-11-4-5-14(18)15(7-11)19-9-12-2-1-3-13(6-12)10-20-16(21)22/h4-5,7,12-13,19-20H,1-3,6,9-10,18H2,(H,21,22)/t12-,13+/m0/s1 |
| InChIKey | STPIWNJTRCZVDQ-QWHCGFSZSA-N |
| XLogP | 2.63 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|