About 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal
2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal (PubChem CID 153395781) has the molecular formula C15H25N3O3
and a molecular weight of 295.38 g/mol. Its IUPAC name is 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal.
Molecular Properties
| Compound Name | 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal |
| PubChem CID | 153395781 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal |
| SMILES | CCCCNC.NCC(=O)O.O=C/C=C/c1cccnc1 |
| InChI | InChI=1S/C8H7NO.C5H13N.C2H5NO2/c10-6-2-4-8-3-1-5-9-7-8;1-3-4-5-6-2;3-1-2(4)5/h1-7H;6H,3-5H2,1-2H3;1,3H2,(H,4,5)/b4-2+;; |
| InChIKey | IBFQAQBOMIVACI-IKXJGISXSA-N |
| XLogP | 1.33 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal?
The IUPAC name of 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal (CID 153395781) is 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal.
What is the SMILES notation for 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal?
The canonical SMILES for 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal is CCCCNC.NCC(=O)O.O=C/C=C/c1cccnc1.
What is the InChIKey of 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal?
The InChIKey is IBFQAQBOMIVACI-IKXJGISXSA-N. The full InChI is InChI=1S/C8H7NO.C5H13N.C2H5NO2/c10-6-2-4-8-3-1-5-9-7-8;1-3-4-5-6-2;3-1-2(4)5/h1-7H;6H,3-5H2,1-2H3;1,3H2,(H,4,5)/b4-2+;;.
What are the key properties of 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal?
2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal has a molecular weight of 295.38 g/mol, XLogP of 1.33, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;N-methylbutan-1-amine;(E)-3-pyridin-3-ylprop-2-enal is sourced from PubChem (CID 153395781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).