C13H13ClN2OS2 — CID 15339626
2-chloro-N-[1-cyano-2,2-bis(methylsulfanyl)ethenyl]-N-methylbenzamide (PubChem CID 15339626) has the molecular formula C13H13ClN2OS2 and a molecular weight of 312.85 g/mol. Its IUPAC name is 2-chloro-N-[1-cyano-2,2-bis(methylsulfanyl)ethenyl]-N-methylbenzamide.
| Compound Name | 2-chloro-N-[1-cyano-2,2-bis(methylsulfanyl)ethenyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 15339626 |
| Molecular Formula | C13H13ClN2OS2 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 2-chloro-N-[1-cyano-2,2-bis(methylsulfanyl)ethenyl]-N-methylbenzamide |
| SMILES | CSC(SC)=C(C#N)N(C)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H13ClN2OS2/c1-16(11(8-15)13(18-2)19-3)12(17)9-6-4-5-7-10(9)14/h4-7H,1-3H3 |
| InChIKey | DSSFLTHZMJTBAZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|