C14H15N6O+ — CID 153396446
2-[1-(benzotriazol-1-ylmethyl)pyridin-1-ium-3-yl]acetohydrazide (PubChem CID 153396446) has the molecular formula C14H15N6O+ and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-[1-(benzotriazol-1-ylmethyl)pyridin-1-ium-3-yl]acetohydrazide.
| Compound Name | 2-[1-(benzotriazol-1-ylmethyl)pyridin-1-ium-3-yl]acetohydrazide |
|---|---|
| PubChem CID | 153396446 |
| Molecular Formula | C14H15N6O+ |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[1-(benzotriazol-1-ylmethyl)pyridin-1-ium-3-yl]acetohydrazide |
| SMILES | NNC(=O)Cc1ccc[n+](Cn2nnc3ccccc32)c1 |
| InChI | InChI=1S/C14H14N6O/c15-16-14(21)8-11-4-3-7-19(9-11)10-20-13-6-2-1-5-12(13)17-18-20/h1-7,9H,8,10H2,(H2-,15,16,17,18,21)/p+1 |
| InChIKey | BQPLUUPMDYJHPD-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|