C24H34N4O2S — CID 153397533
methanol;1-[4-[4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-N-methylsulfanylethanamine (PubChem CID 153397533) has the molecular formula C24H34N4O2S and a molecular weight of 442.63 g/mol. Its IUPAC name is methanol;1-[4-[4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-N-methylsulfanylethanamine.
| Compound Name | methanol;1-[4-[4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-N-methylsulfanylethanamine |
|---|---|
| PubChem CID | 153397533 |
| Molecular Formula | C24H34N4O2S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | methanol;1-[4-[4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]-N-methylsulfanylethanamine |
| SMILES | CO.CSNC(C)c1ccc(-c2c[nH]c3nccc(OCC4(C)CCNCC4)c23)cc1 |
| InChI | InChI=1S/C23H30N4OS.CH4O/c1-16(27-29-3)17-4-6-18(7-5-17)19-14-26-22-21(19)20(8-11-25-22)28-15-23(2)9-12-24-13-10-23;1-2/h4-8,11,14,16,24,27H,9-10,12-13,15H2,1-3H3,(H,25,26);2H,1H3 |
| InChIKey | PBQPYGBLMNVDRA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 82.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|