C22H29FN4OS — CID 153397621
3-(4-ethyl-3-fluorophenyl)-4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridine;thiohydroxylamine (PubChem CID 153397621) has the molecular formula C22H29FN4OS and a molecular weight of 416.57 g/mol. Its IUPAC name is 3-(4-ethyl-3-fluorophenyl)-4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridine;thiohydroxylamine.
| Compound Name | 3-(4-ethyl-3-fluorophenyl)-4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridine;thiohydroxylamine |
|---|---|
| PubChem CID | 153397621 |
| Molecular Formula | C22H29FN4OS |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | 3-(4-ethyl-3-fluorophenyl)-4-[(4-methylpiperidin-4-yl)methoxy]-1H-pyrrolo[2,3-b]pyridine;thiohydroxylamine |
| SMILES | CCc1ccc(-c2c[nH]c3nccc(OCC4(C)CCNCC4)c23)cc1F.NS |
| InChI | InChI=1S/C22H26FN3O.H3NS/c1-3-15-4-5-16(12-18(15)23)17-13-26-21-20(17)19(6-9-25-21)27-14-22(2)7-10-24-11-8-22;1-2/h4-6,9,12-13,24H,3,7-8,10-11,14H2,1-2H3,(H,25,26);2H,1H2 |
| InChIKey | SBEJOKPITNRLAC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|